Name | 3-(methylthio)propyl acetate |
Synonyms | FEMA 3883 methionol acetate 3-MEHTYLTHIO PROPYL ACETATE 3-Methylthio propyl acetate 3-(methylthio)propyl acetate 3-(METHYLTHIO)PROPYL ACETATE 3-ACETOXYPROPYL METHYL SULFIDE 3-(METHYLTHIO)-1-PROPANOACETATE 3-(methylsulfanyl)propyl acetate 3-(Methylmercapto)-propyl acetate 1-Propanol, 3-(methylthio)-, acetate |
CAS | 16630-55-0 |
EINECS | 240-679-2 |
InChI | InChI=1/C6H12O2S/c1-6(7)8-4-3-5-9-2/h3-5H2,1-2H3 |
Molecular Formula | C6H12O2S |
Molar Mass | 148.22 |
Density | 1.041 g/cm3 |
Boling Point | 96°C/14mmHg(lit.) |
Flash Point | 84.5°C |
JECFA Number | 478 |
Vapor Presure | 0.247mmHg at 25°C |
Appearance | clear liquid |
Color | Colorless to Almost colorless |
Refractive Index | 1.4610-1.4650 |
FEMA | 3883 | 3-(METHYLTHIO)PROPYL ACETATE |
NIST chemical information | information provided by: webbook.nist.gov (external link) |
toxicity | GRAS(FEMA). |
usage limit | FEMA(mg/kg): baked products, meat products, soup products, 0.1~0.5; beverages (non-alcoholic, alcoholic), sweets, frosting, cold drinks, gels and pudding, sauces, 0.1 to 0.2; Flavorings 50. |